loading...| Preferred Name |
butyrate |
|
| Synonyms |
butanoate butyrate propanecarboxylate CH3-[CH2]2-COO(-) 1-butanoate 1-propanecarboxylate butanoic acid, ion(1-) n-butanoate propylformate 1-butyrate butanate n-butyrate |
|
| Definitions |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17968 |
|
| charge |
-1 |
|
| database_cross_reference |
Gmelin:324289 Reaxys:3601060 PMID:7496326 CAS:461-55-2 PMID:17190852 MetaCyc:BUTYRIC_ACID UM-BBD_compID:c0035 Beilstein:3601060 KEGG:C00246 |
|
| definition |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
| formula |
C4H7O2 |
|
| has role | ||
| has_exact_synonym |
butanoate butyrate |
|
| has_related_synonym |
propanecarboxylate CH3-[CH2]2-COO(-) 1-butanoate 1-propanecarboxylate butanoic acid, ion(1-) n-butanoate propylformate 1-butyrate butanate butanoate n-butyrate |
|
| hasAlternativeId |
CHEBI:22946 CHEBI:13924 |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:17968 |
|
| inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
|
| inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-M |
|
| inSubset | ||
| is_conjugate_base_of | ||
| label |
butyrate |
|
| mass |
87.09718 |
|
| monoisotopicmass |
87.04515 |
|
| notation |
CHEBI:17968 |
|
| prefLabel |
butyrate |
|
| smiles |
CCCC([O-])=O |
|
| subClassOf |