Preferred Name |
bupropion |
|
Synonyms |
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one Bupropion InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-N CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 C13H18ClNO InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 |
|
Definitions |
A propanone that has formula C13H18ClNO. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3219 |
|
database_cross_reference |
KEGG COMPOUND:34841-39-9 ChemIDplus:2101062 Wikipedia:Bupropion ChemIDplus:34911-55-2 KEGG COMPOUND:C06860 |
|
definition |
A propanone that has formula C13H18ClNO. |
|
has_exact_synonym |
2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one Bupropion |
|
has_related_synonym |
InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-N CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1 C13H18ClNO InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 |
|
has_RxCUI |
42347 |
|
id |
CHEBI:3219 |
|
imported from | ||
label |
Bupropion bupropion |
|
notation |
CHEBI:3219 |
|
prefLabel |
bupropion |
|
subClassOf |
Create mapping