loading...| Preferred Name |
heptanoic acid |
|
| Synonyms |
heptanoic acid HEPTANOIC ACID CH3-[CH2]5-COOH n-heptylic acid heptylic acid MNWFXJYAOYHMED-UHFFFAOYSA-N n-heptoic acid n-heptanoic acid oenanthylic acid oenanthic acid CCCCCCC(O)=O heptoic acid Oenanthsaeure InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) enanthylic acid enanthic acid 130.18486 C7H14O2 Heptansaeure |
|
| Definitions |
A C7, straight-chain fatty acid that contributes to the odour of some rancid oils. Used in the preparation of esters for the fragrance industry, and as an additive in cigarettes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_45571 |
|
| database_cross_reference |
Reaxys:1744723 PDBeChem:SHV Beilstein:1744723 Wikipedia:Heptanoic_acid HMDB:HMDB00666 Gmelin:142428 DrugBank:DB02938 LIPID_MAPS_instance:LMFA01010007 MetaCyc:CPD-7619 PMID:23999410 KEGG:C17714 CAS:111-14-8 |
|
| definition |
A C7, straight-chain fatty acid that contributes to the odour of some rancid oils. Used in the preparation of esters for the fragrance industry, and as an additive in cigarettes. |
|
| has role | ||
| has_alternative_id |
CHEBI:45568 CHEBI:24519 |
|
| has_exact_synonym |
heptanoic acid HEPTANOIC ACID |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CH3-[CH2]5-COOH n-heptylic acid heptylic acid MNWFXJYAOYHMED-UHFFFAOYSA-N n-heptoic acid n-heptanoic acid oenanthylic acid oenanthic acid CCCCCCC(O)=O heptoic acid Oenanthsaeure InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) enanthylic acid enanthic acid 130.18486 C7H14O2 Heptansaeure |
|
| id |
CHEBI:45571 |
|
| imported from | ||
| is conjugate acid of | ||
| label |
heptanoic acid |
|
| notation |
CHEBI:45571 |
|
| prefLabel |
heptanoic acid |
|
| subClassOf |