loading...| Preferred Name |
hydroxytyrosol |
|
| Synonyms |
C8H10O3 3,4-dihydroxyphenylethanol 154.16320 dopet JUUBCHWRXWPFFH-UHFFFAOYSA-N InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 OCCc1ccc(O)c(O)c1 4-(2-hydroxyethyl)benzene-1,2-diol |
|
| Definitions |
A member of the class of catechols that is benzene-1,2-diol substituted by a 2-hydroxyethyl group at position 4. Isolated from Olea europaea, it exhibits antioxidant and antineoplastic activities. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_68889 |
|
| database_cross_reference |
PMID:23244583 Reaxys:2208118 CAS:10597-60-1 PMID:22014120 Wikipedia:Hydroxytyrosol LINCS:LSM-36968 PMID:23017390 PMID:22924436 |
|
| definition |
A member of the class of catechols that is benzene-1,2-diol substituted by a 2-hydroxyethyl group at position 4. Isolated from Olea europaea, it exhibits antioxidant and antineoplastic activities. |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
4-(2-hydroxyethyl)benzene-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
C8H10O3 3,4-dihydroxyphenylethanol 154.16320 dopet JUUBCHWRXWPFFH-UHFFFAOYSA-N InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 OCCc1ccc(O)c(O)c1 |
|
| id |
CHEBI:68889 |
|
| imported from | ||
| label |
hydroxytyrosol |
|
| notation |
CHEBI:68889 |
|
| prefLabel |
hydroxytyrosol |
|
| subClassOf |