loading...| Preferred Name |
butane-1,2,3,4-tetrol |
|
| Synonyms |
butane-1,2,3,4-tetrol Phycitol OCC(O)C(O)CO 122.11980 Phycite 1,2,3,4-tetrahydroxybutane InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 Erythrol Erythrite C4H10O4 UNXHWFMMPAWVPI-UHFFFAOYSA-N |
|
| Definitions |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48299 |
|
| database_cross_reference |
KNApSAcK:C00001161 CAS:7541-59-5 KEGG:C00503 CAS:149-32-6 KEGG:D08915 Beilstein:1735878 Reaxys:1735878 |
|
| definition |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
| has_exact_synonym |
butane-1,2,3,4-tetrol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Phycitol OCC(O)C(O)CO 122.11980 Phycite 1,2,3,4-tetrahydroxybutane InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 Erythrol Erythrite C4H10O4 UNXHWFMMPAWVPI-UHFFFAOYSA-N |
|
| id |
CHEBI:48299 |
|
| imported from | ||
| label |
butane-1,2,3,4-tetrol |
|
| notation |
CHEBI:48299 |
|
| prefLabel |
butane-1,2,3,4-tetrol |
|
| subClassOf |