loading...| Preferred Name |
benzamide |
|
| Synonyms |
benzamide Benzamide NC(=O)c1ccccc1 PhC(O)NH2 121.13662 PhC(=O)NH2 Phenylcarboxyamide KXDAEFPNCMNJSK-UHFFFAOYSA-N Phenylcarboxamide C7H7NO Benzoylamide Benzenecarboxamide Benzoic acid amide InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
|
| Definitions |
An aromatic amide that consists of benzene bearing a single carboxamido substituent. The parent of the class of benzamides. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28179 |
|
| database_cross_reference |
KEGG:C09815 HMDB:HMDB04461 PMID:20133863 CAS:55-21-0 Wikipedia:Benzamide UM-BBD_compID:c0368 Beilstein:385876 Reaxys:385876 |
|
| definition |
An aromatic amide that consists of benzene bearing a single carboxamido substituent. The parent of the class of benzamides. |
|
| has_alternative_id |
CHEBI:3021 CHEBI:22701 CHEBI:46351 |
|
| has_exact_synonym |
benzamide Benzamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
NC(=O)c1ccccc1 PhC(O)NH2 121.13662 PhC(=O)NH2 Phenylcarboxyamide KXDAEFPNCMNJSK-UHFFFAOYSA-N Phenylcarboxamide C7H7NO Benzoylamide Benzenecarboxamide Benzoic acid amide InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
|
| id |
CHEBI:28179 |
|
| imported from | ||
| label |
benzamide |
|
| notation |
CHEBI:28179 |
|
| prefLabel |
benzamide |
|
| subClassOf |