Jump to:
loading...| Preferred Name |
(S)-warfarin |
|
| Synonyms |
|
|
| Definitions |
A 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one that has (S)-configuration (the racemate is warfarin, an anticoagulant drug and rodenticide). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_87738 |
|
| charge |
0 |
|
| definition |
A 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one that has (S)-configuration (the racemate is warfarin, an anticoagulant drug and rodenticide). |
|
| formula |
C19H16O4 |
|
| inchi |
InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m0/s1 |
|
| inchikey |
PJVWKTKQMONHTI-HNNXBMFYSA-N |
|
| is_conjugate_acid_of | ||
| is_enantiomer_of | ||
| label |
(S)-warfarin |
|
| mass |
308.329 |
|
| monoisotopicmass |
308.10486 |
|
| prefixIRI |
CHEBI:87738 |
|
| prefLabel |
(S)-warfarin |
|
| smiles |
C1=CC=CC2=C1C(=C(C(O2)=O)[C@@H](CC(C)=O)C3=CC=CC=C3)O |
|
| subClassOf |
Create mapping