Preferred Name |
isobutane |
|
Synonyms |
|
|
Definitions |
An alkane that is propane substituted by a methyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30363 |
|
charge |
0 |
|
definition |
An alkane that is propane substituted by a methyl group at position 2. |
|
formula |
C4H10 |
|
has role | ||
inchi |
InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 |
|
inchikey |
NNPPMTNAJDCUHE-UHFFFAOYSA-N |
|
label |
isobutane |
|
mass |
58.12220 |
|
monoisotopicmass |
58.07825 |
|
prefixIRI |
CHEBI:30363 |
|
prefLabel |
isobutane |
|
smiles |
CC(C)C |
|
subClassOf |
Create mapping