Jump to:
loading...| Preferred Name |
icosanoic acid |
|
| Synonyms |
|
|
| Definitions |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28822 |
|
| charge |
0 |
|
| definition |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| formula |
C20H40O2 |
|
| has role | ||
| inchi |
InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) |
|
| inchikey |
VKOBVWXKNCXXDE-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
icosanoic acid |
|
| mass |
312.53040 |
|
| monoisotopicmass |
312.30283 |
|
| prefixIRI |
CHEBI:28822 |
|
| prefLabel |
icosanoic acid |
|
| smiles |
CCCCCCCCCCCCCCCCCCCC(O)=O |
|
| subClassOf |
Create mapping