Jump to:
loading...| Preferred Name |
rac-lactic acid |
|
| Synonyms |
|
|
| Definitions |
A racemate comprising equimolar amounts of (R)- and (S)-lactic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28358 |
|
| charge |
0 |
|
| definition |
A racemate comprising equimolar amounts of (R)- and (S)-lactic acid. |
|
| formula |
C3H6O3 |
|
| has characteristic | ||
| has part | ||
| has role | ||
| inchi |
InChI=1S/2C3H6O3/c2*1-2(4)3(5)6/h2*2,4H,1H3,(H,5,6)/t2*2-/m10/s1 |
|
| inchikey |
KVZLHPXEUGJPAH-QNDGGIRCSA-N |
|
| is_conjugate_acid_of | ||
| label |
rac-lactic acid |
|
| mass |
180.156 |
|
| monoisotopicmass |
180.06339 |
|
| overlaps | ||
| prefixIRI |
CHEBI:28358 |
|
| prefLabel |
rac-lactic acid |
|
| smiles |
C(=O)([C@@H](O)C)O.C(=O)([C@H](O)C)O |
|
| subClassOf |
Create mapping