loading...| Preferred Name |
L-histidine |
|
| Synonyms |
|
|
| Definitions |
The L-enantiomer of the amino acid histidine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15971 |
|
| charge |
0 |
|
| definition |
The L-enantiomer of the amino acid histidine. |
|
| formula |
C6H9N3O2 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 |
|
| inchi |
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
|
| inchikey |
HNDVDQJCIGZPNO-YFKPBYRVSA-N |
|
| is_conjugate_acid_of | ||
| is_conjugate_base_of | ||
| is_enantiomer_of | ||
| is_tautomer_of | ||
| label |
L-histidine |
|
| mass |
155.15468 |
|
| monoisotopicmass |
155.06948 |
|
| prefixIRI |
CHEBI:15971 |
|
| prefLabel |
L-histidine |
|
| smiles |
N[C@@H](Cc1c[nH]cn1)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 |