Preferred Name |
succinic acid |
|
Synonyms |
|
|
Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
charge |
0 |
|
definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
formula |
C4H6O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_66987 http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
inchi |
InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
|
inchikey |
KDYFGRWQOYBRFD-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
label |
succinic acid |
|
mass |
118.08800 |
|
monoisotopicmass |
118.02661 |
|
prefixIRI |
CHEBI:15741 |
|
prefLabel |
succinic acid |
|
smiles |
OC(=O)CCC(O)=O |
|
subClassOf |