Preferred Name |
pyruvate |
|
Synonyms |
|
|
Definitions |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
charge |
-1 |
|
definition |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
formula |
C3H3O3 |
|
has role | ||
has_functional_parent | ||
inchi |
InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 |
|
inchikey |
LCTONWCANYUPML-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
pyruvate |
|
mass |
87.05412 |
|
monoisotopicmass |
87.00877 |
|
prefixIRI |
CHEBI:15361 |
|
prefLabel |
pyruvate |
|
smiles |
CC(=O)C([O-])=O |
|
subClassOf |
Create mapping