loading...| Preferred Name |
5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide |
|
| Synonyms |
|
|
| Definitions |
A secondary amino compound that is ammonia in which nitrogen is substituted by a 1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl group and a 2-(2-ethoxyphenoxy)ethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_142546 |
|
| charge |
0 |
|
| definition |
A secondary amino compound that is ammonia in which nitrogen is substituted by a 1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl group and a 2-(2-ethoxyphenoxy)ethyl group. |
|
| formula |
C20H28N2O5S |
|
| inchi |
InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24) |
|
| inchikey |
DRHKJLXJIQTDTD-UHFFFAOYSA-N |
|
| label |
5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide |
|
| mass |
408.514 |
|
| monoisotopicmass |
408.17189 |
|
| prefixIRI |
CHEBI:142546 |
|
| prefLabel |
5-(2-{[2-(2-ethoxyphenoxy)ethyl]amino}propyl)-2-methoxybenzenesulfonamide |
|
| smiles |
C=1C=C(OCCNC(CC2=CC=C(C(=C2)S(N)(=O)=O)OC)C)C(=CC1)OCC |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |