Preferred Name |
finasteride |
|
Synonyms |
N-tert-butyl-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide (5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide finasteride finasteridum finasterida |
|
Definitions |
An aza-steroid that is a synthetic drug for the treatment of benign prostatic hyperplasia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5062 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00321 LINCS:LSM-1999 CAS:98319-26-7 Reaxys:4269024 Patent:US4760071 PMID:15956333 HMDB:HMDB0001984 Patent:EP155096 Drug_Central:1171 DrugBank:DB01216 Beilstein:4269024 Wikipedia:Finasteride PMID:23552442 |
|
definition |
An aza-steroid that is a synthetic drug for the treatment of benign prostatic hyperplasia. |
|
formula |
C23H36N2O2 |
|
has exact synonym |
N-tert-butyl-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
has parent hydride | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35497 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(5alpha,17beta)-(1,1-Dimethylethyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide finasteride finasteridum finasterida |
|
id |
CHEBI:5062 |
|
in_subset | ||
inchi |
InChI=1S/C23H36N2O2/c1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/h11,13-18H,6-10,12H2,1-5H3,(H,24,26)(H,25,27)/t14-,15-,16-,17+,18+,22-,23+/m0/s1 |
|
inchikey |
DBEPLOCGEIEOCV-WSBQPABSSA-N |
|
label |
finasteride |
|
mass |
372.545 |
|
monoisotopicmass |
372.27768 |
|
notation |
CHEBI:5062 |
|
prefLabel |
finasteride |
|
smiles |
C1=CC(N[C@]2([C@]1([C@@]3([C@@](CC2)([C@]4([C@](CC3)([C@](CC4)(C(NC(C)(C)C)=O)[H])C)[H])[H])[H])C)[H])=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35726 |