loading...| Preferred Name |
arachidonic acid |
|
| Synonyms |
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid Arachidonic acid ARACHIDONIC ACID (5Z,8Z,11Z,14Z)-Icosatetraenoic acid all-cis-5,8,11,14-eicosatetraenoic acid cis-5,8,11,14-Eicosatetraenoic acid (5Z,8Z,11Z,14Z)-5,8,11,14-icosatetraenoic acid ARA Arachidonate Arachidonsaeure cis-Delta(5,8,11,14)-eicosatetraenoic acid AA |
|
| Definitions |
(5Z, 8Z, 11Z, 14Z)-icosa-5, 8, 11, 14-tetraenoic acid A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15843 |
|
| comment |
(5Z, 8Z, 11Z, 14Z)-icosa-5, 8, 11, 14-tetraenoic acid |
|
| charge |
0 |
|
| createdDate |
September 23, 2009 |
|
| database_cross_reference |
PMID:15129302 KEGG:C00219 DrugBank:DB04557 Gmelin:58972 PDBeChem:ACD PMID:18973997 Wikipedia:Arachidonic_acid Beilstein:1913991 MetaCyc:ARACHIDONIC_ACID PMID:2820055 KNApSAcK:C00000388 HMDB:HMDB0001043 PMID:18931599 LIPID_MAPS_instance:LMFA01030001 PMID:25584012 CAS:506-32-1 Reaxys:1913991 |
|
| definition |
A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
| formula |
C20H32O2 |
|
| has exact synonym |
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid Arachidonic acid ARACHIDONIC ACID |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_83038 |
|
| has_alternative_id |
CHEBI:2799 CHEBI:40501 CHEBI:22608 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(5Z,8Z,11Z,14Z)-Icosatetraenoic acid all-cis-5,8,11,14-eicosatetraenoic acid cis-5,8,11,14-Eicosatetraenoic acid (5Z,8Z,11Z,14Z)-5,8,11,14-icosatetraenoic acid ARA Arachidonate Arachidonsaeure cis-Delta(5,8,11,14)-eicosatetraenoic acid AA |
|
| id |
CHEBI:15843 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15- |
|
| inchikey |
YZXBAPSDXZZRGB-DOFZRALJSA-N |
|
| is conjugate acid of | ||
| label |
arachidonic acid |
|
| mass |
304.46690 |
|
| monoisotopicmass |
304.24023 |
|
| notation |
CHEBI:15843 |
|
| prefLabel |
arachidonic acid |
|
| smiles |
CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O |
|
| subClassOf |
http://uri.neuinfo.org/nif/nifstd/nifext_5157 http://purl.obolibrary.org/obo/CHEBI_36306 |