Preferred Name |
succinic acid |
|
Synonyms |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid Dihydrofumaric acid acide succinique Butandisaeure asuccin acidum succinicum Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 spirit of amber Bernsteinsaeure |
|
Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
charge |
0 |
|
database_cross_reference |
MetaCyc:SUC Drug_Central:2487 Reaxys:1754069 PMID:17439666 CAS:110-15-6 HMDB:HMDB0000254 KEGG:C00042 Wikipedia:Succinic_acid LIPID_MAPS_instance:LMFA01170043 ECMDB:ECMDB00254 DrugBank:DB00139 PDBeChem:SIN Beilstein:1754069 Gmelin:2785 YMDB:YMDB00338 KNApSAcK:C00001205 |
|
definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
formula |
C4H6O4 |
|
has exact synonym |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_66987 http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
has_alternative_id |
CHEBI:9304 CHEBI:22943 CHEBI:45639 CHEBI:26807 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dihydrofumaric acid acide succinique Butandisaeure asuccin acidum succinicum Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid amber acid acide butanedioique 1,2-ethanedicarboxylic acid E363 spirit of amber Bernsteinsaeure |
|
id |
CHEBI:15741 |
|
in_subset | ||
inchi |
InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
|
inchikey |
KDYFGRWQOYBRFD-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
succinic acid |
|
mass |
118.08800 |
|
monoisotopicmass |
118.02661 |
|
notation |
CHEBI:15741 |
|
prefLabel |
succinic acid |
|
smiles |
OC(=O)CCC(O)=O |
|
subClassOf |