Preferred Name |
sodium valproate |
|
Synonyms |
Epilim valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Valproate sodium sodium 2-propylpentanoate |
|
Definitions |
The sodium salt of valproic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9925 |
|
alternative label |
Epilim valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Valproate sodium sodium 2-propylpentanoate |
|
charge |
0 |
|
database_cross_reference |
CAS:1069-66-5 DrugBank:DBSALT001257 PMID:18248662 KEGG:C07842 KEGG:D00710 |
|
definition |
The sodium salt of valproic acid. |
|
formula |
C8H15O2Na |
|
has characteristic | ||
has exact synonym |
sodium 2-propylpentanoate |
|
has part | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Epilim valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Valproate sodium |
|
id |
CHEBI:9925 |
|
in_subset | ||
inchi |
InChI=1S/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
|
inchikey |
AEQFSUDEHCCHBT-UHFFFAOYSA-M |
|
label |
sodium valproate |
|
mass |
166.19327 |
|
monoisotopicmass |
166.09697 |
|
notation |
CHEBI:9925 |
|
note |
The sodium salt of valproic acid. |
|
overlaps | ||
preferred label |
sodium valproate |
|
prefLabel |
sodium valproate |
|
smiles |
[Na+].CCCC(CCC)C([O-])=O |
|
subClassOf |