loading...| Preferred Name |
guanadrel |
|
| Synonyms |
1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel guanadrel guanadrelum |
|
| Definitions |
A spiroketal resulting from the formal condensation of the keto group of cyclohexanone with the hydroxy groups of 1-(2,3-dihydroxypropyl)guanidine. A postganglionic adrenergic blocking agent formerly used (generally as the sulfate salt) for the management of hypertension, it has been largely superseded by other drugs less likely to cause orthostatic hypotension (dizzy spells on standing up or stretching). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5555 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08029 CAS:40580-59-4 Beilstein:8325419 KEGG:C07035 Wikipedia:Guanadrel PMID:7206175 Patent:US3547951 Drug_Central:1339 Reaxys:8325419 HMDB:HMDB0014371 PMID:3896742 PMID:6621504 DrugBank:DB00226 |
|
| definition |
A spiroketal resulting from the formal condensation of the keto group of cyclohexanone with the hydroxy groups of 1-(2,3-dihydroxypropyl)guanidine. A postganglionic adrenergic blocking agent formerly used (generally as the sulfate salt) for the management of hypertension, it has been largely superseded by other drugs less likely to cause orthostatic hypotension (dizzy spells on standing up or stretching). |
|
| formula |
C10H19N3O2 |
|
| has exact synonym |
1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
guanadrel guanadrelum |
|
| id |
CHEBI:5555 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
|
| inchikey |
HPBNRIOWIXYZFK-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
guanadrel |
|
| mass |
213.27680 |
|
| monoisotopicmass |
213.14773 |
|
| notation |
CHEBI:5555 |
|
| prefLabel |
guanadrel |
|
| smiles |
NC(=N)NCC1COC2(CCCCC2)O1 |
|
| subClassOf |