loading...| Preferred Name |
zuclopenthixol |
|
| Synonyms |
2-{4-[(3Z)-3-(2-chloro-10H-dibenzo[b,e]thiopyran-10-ylidene)propyl]piperazin-1-yl}ethanol zuclopentixol (Z)-4-(3-(2-Chlorothioxanthen-9-ylidene)propyl)-1-piperazineethanol zuclopenthixolum zuclopenthixol |
|
| Definitions |
The (Z)-isomer of clopenthixol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51364 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:53772-83-1 DrugBank:DB01624 Beilstein:8447014 Drug_Central:2877 KEGG:D03556 |
|
| definition |
The (Z)-isomer of clopenthixol. |
|
| formula |
C22H25ClN2OS |
|
| has exact synonym |
2-{4-[(3Z)-3-(2-chloro-10H-dibenzo[b,e]thiopyran-10-ylidene)propyl]piperazin-1-yl}ethanol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
zuclopentixol (Z)-4-(3-(2-Chlorothioxanthen-9-ylidene)propyl)-1-piperazineethanol zuclopenthixolum zuclopenthixol |
|
| id |
CHEBI:51364 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H25ClN2OS/c23-17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)27-22)5-3-9-24-10-12-25(13-11-24)14-15-26/h1-2,4-8,16,26H,3,9-15H2/b18-5- |
|
| inchikey |
WFPIAZLQTJBIFN-DVZOWYKESA-N |
|
| label |
zuclopenthixol |
|
| mass |
400.96548 |
|
| monoisotopicmass |
400.13761 |
|
| notation |
CHEBI:51364 |
|
| prefLabel |
zuclopenthixol |
|
| smiles |
OCCN1CCN(CC\C=C2\c3ccccc3Sc3ccc(Cl)cc23)CC1 |
|
| subClassOf |