Preferred Name |
butyric acid |
|
Synonyms |
butanoic acid butyric acid Butyric acid CH3-[CH2]2-COOH acide butanoique BUTANOIC ACID n-butanoic acid butoic acid Butanoic acid C4:0 acide butyrique Butanoate n-butyric acid 4:0 1-butanoic acid propanecarboxylic acid ethylacetic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 1-propanecarboxylic acid |
|
Definitions |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30772 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Butyric_acid PMID:12068484 PMID:19366864 HMDB:HMDB0000039 PMID:21699495 PMID:15938880 PMID:11208715 MetaCyc:BUTYRIC_ACID DrugBank:DB03568 Gmelin:26242 Beilstein:906770 CAS:107-92-6 PMID:11305323 PMID:1542095 PMID:22322557 PDBeChem:BUA PMID:11201044 KNApSAcK:C00001180 PMID:11238216 KEGG:C00246 LIPID_MAPS_instance:LMFA01010004 PMID:13678314 PMID:14962641 PMID:22339023 PMID:10956204 PMID:10736622 PMID:19703412 PMID:19318247 PMID:22194341 PMID:15809727 Reaxys:906770 PMID:22038864 PMID:15810631 PMID:22466881 |
|
definition |
A straight-chain saturated fatty acid that is butane in which one of the terminal methyl groups has been oxidised to a carboxy group. |
|
formula |
C4H8O2 |
|
has exact synonym |
butanoic acid butyric acid Butyric acid |
|
has role | ||
has_alternative_id |
CHEBI:22948 CHEBI:41208 CHEBI:113450 CHEBI:3234 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
CH3-[CH2]2-COOH acide butanoique BUTANOIC ACID n-butanoic acid butoic acid Butanoic acid C4:0 acide butyrique Butanoate n-butyric acid 4:0 1-butanoic acid propanecarboxylic acid ethylacetic acid butanic acid 1-butyric acid Buttersaeure propylformic acid 1-propanecarboxylic acid |
|
id |
CHEBI:30772 |
|
in_subset | ||
inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) |
|
inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
butyric acid |
|
mass |
88.10510 |
|
monoisotopicmass |
88.05243 |
|
notation |
CHEBI:30772 |
|
prefLabel |
butyric acid |
|
smiles |
CCCC(O)=O |
|
subClassOf |