loading...| Preferred Name |
mescaline |
|
| Synonyms |
2-(3,4,5-trimethoxyphenyl)ethanamine Mescaline Meskalin 3,4,5-trimethoxyphenethylamine 1-amino-2-(3,4,5-trimethoxyphenyl)ethane mescalina 3,4,5-trimethoxybenzeneethanamine TMPEA 3,4,5-trimethoxyphenylethylamine Mescalin mezcalina 2-(3, 4, 5-trimethoxyphenyl)ethanamine |
|
| Definitions |
A phenethylamine alkaloid that has formula C11H17NO3. Street names: buttons, cactus, mesc, peyote A phenethylamine alkaloid that is phenethylamine substituted at positions 3, 4 and 5 by methoxy groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28346 |
|
| comment |
Street names: buttons, cactus, mesc, peyote |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
CAS:54-04-6 Reaxys:1374088 PMID:25036425 PMID:22251567 KEGG:C06546 PMID:20890669 PMID:14516493 Beilstein:1374088 Wikipedia:Mescaline PMID:22900815 KNApSAcK:C00001419 |
|
| definition |
A phenethylamine alkaloid that has formula C11H17NO3. |
|
| formula |
C11H17NO3 |
|
| has characteristic | ||
| has exact synonym |
2-(3,4,5-trimethoxyphenyl)ethanamine Mescaline |
|
| has role | ||
| has_alternative_id |
CHEBI:25202 CHEBI:6776 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Meskalin 3,4,5-trimethoxyphenethylamine 1-amino-2-(3,4,5-trimethoxyphenyl)ethane mescalina 3,4,5-trimethoxybenzeneethanamine TMPEA 3,4,5-trimethoxyphenylethylamine Mescalin mezcalina |
|
| hasStreetName |
cactus buttons mesc peyote |
|
| id |
CHEBI:28346 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H17NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4-5,12H2,1-3H3 |
|
| inchikey |
RHCSKNNOAZULRK-UHFFFAOYSA-N |
|
| label |
mescaline |
|
| mass |
211.25760 |
|
| modifiedDate |
June 30, 2010 |
|
| monoisotopicmass |
211.12084 |
|
| notation |
CHEBI:28346 |
|
| prefLabel |
mescaline |
|
| smiles |
COc1cc(CCN)cc(OC)c1OC |
|
| synonym |
2-(3, 4, 5-trimethoxyphenyl)ethanamine |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_51683 http://purl.obolibrary.org/obo/CHEBI_50994 |