Preferred Name |
p-menthan-3-ol |
|
Synonyms |
|
|
Definitions |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25187 |
|
charge |
0 |
|
definition |
Any secondary alcohol that is one of the eight possible diastereoisomers of 5-methyl-2-(propan-2-yl)cyclohexan-1-ol. |
|
formula |
C10H20O |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:25187 |
|
in_subset | ||
inchi |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3 |
|
inchikey |
NOOLISFMXDJSKH-UHFFFAOYSA-N |
|
label |
p-menthan-3-ol |
|
mass |
156.26520 |
|
monoisotopicmass |
156.15142 |
|
notation |
CHEBI:25187 |
|
prefLabel |
p-menthan-3-ol |
|
smiles |
CC(C)C1CCC(C)CC1O |
|
subClassOf |
Create mapping