Preferred Name |
calcidiol |
|
Synonyms |
calcidiol Calcidiol (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol Rayaldee Calcifediol anhydrous 25-hydroxycholecalciferol 25(OH)D3 25-Hydroxyvitamin D3 (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol (3S,5Z,7E)-9,10-secocholesta-5,7,10-triene-3,25-diol calcifediol calcifediolum Calcifediol 3-{2-[1-(5-HYDROXY-1,5-DIMETHYL-HEXYL)-7A-METHYL-OCTAHYDRO-INDEN-4-YLIDENE]-ETHYLIDENE}-4-METHYLENE-CYCLOHEXANOL (3beta,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol 25-hydroxyvitamin D3 |
|
Definitions |
A hydroxycalciol that is calciol in which the hydrogen at position 25 has been replaced by a hydroxy group. A prehormone resulting from the oxidation of calciol in the liver, it is further hydroxylated in the kidney to give calcitriol, the active form of vitamin D3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17933 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:464 PMID:23090338 PDBeChem:VDY Beilstein:4270041 PMID:18689406 Wikipedia:Calcifediol PMID:23566108 PMID:16549446 PMID:22536761 Reaxys:4270041 PMID:9080330 KEGG:C01561 DrugBank:DB00146 PMID:22487892 LIPID_MAPS_instance:LMST03020246 CAS:19356-17-3 |
|
definition |
A hydroxycalciol that is calciol in which the hydrogen at position 25 has been replaced by a hydroxy group. A prehormone resulting from the oxidation of calciol in the liver, it is further hydroxylated in the kidney to give calcitriol, the active form of vitamin D3. |
|
formula |
C27H44O2 |
|
has exact synonym |
calcidiol Calcidiol (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50646 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:13931 CHEBI:3304 CHEBI:19815 CHEBI:46387 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Rayaldee Calcifediol anhydrous 25-hydroxycholecalciferol 25(OH)D3 25-Hydroxyvitamin D3 (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol (3S,5Z,7E)-9,10-secocholesta-5,7,10-triene-3,25-diol calcifediol calcifediolum Calcifediol 3-{2-[1-(5-HYDROXY-1,5-DIMETHYL-HEXYL)-7A-METHYL-OCTAHYDRO-INDEN-4-YLIDENE]-ETHYLIDENE}-4-METHYLENE-CYCLOHEXANOL (3beta,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol 25-hydroxyvitamin D3 |
|
id |
CHEBI:17933 |
|
in_subset | ||
inchi |
InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1 |
|
inchikey |
JWUBBDSIWDLEOM-DTOXIADCSA-N |
|
label |
calcidiol |
|
mass |
400.63706 |
|
monoisotopicmass |
400.33413 |
|
notation |
CHEBI:17933 |
|
prefLabel |
calcidiol |
|
smiles |
[H][C@@]1(CC[C@]2([H])[C@]1(C)CCC\C2=C/C=C1/C[C@@H](O)CCC1=C)[C@H](C)CCCC(C)(C)O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_73558 |