loading...| Preferred Name |
L-isoleucine |
|
| Synonyms |
L-Isoleucine L-isoleucine (2S,3S)-2-amino-3-methylpentanoic acid Ile alpha-amino-beta-methylvaleric acid 2-Amino-3-methylvaleric acid ISOLEUCINE I |
|
| Definitions |
The L-enantiomer of isoleucine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17191 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:14651987 PMID:24284437 ECMDB:ECMDB00172 Gmelin:486381 PMID:17409434 KNApSAcK:C00001374 MetaCyc:ILE Beilstein:1721792 CAS:73-32-5 Reaxys:1721792 KEGG:D00065 PMID:16140883 HMDB:HMDB0000172 PMID:24738868 PMID:24831709 PDBeChem:ILE Wikipedia:Isoleucine PMID:24406630 PMID:22298573 KEGG:C00407 YMDB:YMDB00038 DrugBank:DB00167 Drug_Central:4129 PMID:17299083 |
|
| definition |
The L-enantiomer of isoleucine. |
|
| formula |
C6H13NO2 |
|
| has exact synonym |
L-Isoleucine L-isoleucine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:43342 CHEBI:13127 CHEBI:43290 CHEBI:43366 CHEBI:6255 CHEBI:21344 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(2S,3S)-2-amino-3-methylpentanoic acid Ile alpha-amino-beta-methylvaleric acid 2-Amino-3-methylvaleric acid ISOLEUCINE I |
|
| id |
CHEBI:17191 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
|
| inchikey |
AGPKZVBTJJNPAG-WHFBIAKZSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-isoleucine |
|
| mass |
131.175 |
|
| monoisotopicmass |
131.09463 |
|
| notation |
CHEBI:17191 |
|
| prefLabel |
L-isoleucine |
|
| smiles |
OC([C@H]([C@H](CC)C)N)=O |
|
| subClassOf |