Jump to:
loading...| Preferred Name |
1-phenylpropan-2-amine |
|
| Synonyms |
1-phenylpropan-2-amine |
|
| Definitions |
A primary amine that is isopropylamine in which a hydrogen attached to one of the methyl groups has been replaced by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_132233 |
|
| charge |
0 |
|
| definition |
A primary amine that is isopropylamine in which a hydrogen attached to one of the methyl groups has been replaced by a phenyl group. |
|
| formula |
C9H13N |
|
| has exact synonym |
1-phenylpropan-2-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:132233 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
|
| inchikey |
KWTSXDURSIMDCE-UHFFFAOYSA-N |
|
| label |
1-phenylpropan-2-amine |
|
| mass |
135.207 |
|
| monoisotopicmass |
135.10480 |
|
| notation |
CHEBI:132233 |
|
| prefLabel |
1-phenylpropan-2-amine |
|
| smiles |
C=1(C=CC=CC1)CC(C)N |
|
| subClassOf |
Create mapping