Preferred Name |
isobutane |
|
Synonyms |
isobutane 2-methylpropane 58.12220 (CH3)2CH-CH3 58.078 InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 E943b R-600a CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0 C4H10 |
|
Definitions |
An alkane that is propane substituted by a methyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30363 |
|
database_cross_reference |
PMID:24179026 PMID:24464945 Beilstein:1730720 Wikipedia:Isobutane KEGG:D04623 CAS:75-28-5 Reaxys:1730720 Gmelin:1301 |
|
has exact synonym |
isobutane 2-methylpropane |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
58.12220 (CH3)2CH-CH3 58.078 InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 E943b R-600a CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0 C4H10 |
|
id |
CHEBI:30363 |
|
in_subset | ||
label |
isobutane |
|
notation |
CHEBI:30363 |
|
prefLabel |
isobutane |
|
textual definition |
An alkane that is propane substituted by a methyl group at position 2. |
|
subClassOf |
Create mapping