loading...| Preferred Name |
isopentane |
|
| Synonyms |
isoamylhydride 1,1,2-trimethylethane (CH3)2CH-CH2-CH3 iso-C5H12 CCC(C)C R-601a 72.094 iso-pentane dimethylethylmethane 72.14878 InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 C5H12 1,1-dimethylpropane 0 QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane 2-methylbutane |
|
| Definitions |
An alkane that is butane substituted by a methyl group at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30362 |
|
| database_cross_reference |
PMID:24833189 Gmelin:49318 PMID:23904008 Reaxys:1730723 Wikipedia:Isopentane CAS:78-78-4 PMID:21481069 Beilstein:1730723 PMID:24932627 |
|
| has exact synonym |
isopentane 2-methylbutane |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
isoamylhydride 1,1,2-trimethylethane (CH3)2CH-CH2-CH3 iso-C5H12 CCC(C)C R-601a 72.094 iso-pentane dimethylethylmethane 72.14878 InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 C5H12 1,1-dimethylpropane 0 QWTDNUCVQCZILF-UHFFFAOYSA-N |
|
| id |
CHEBI:30362 |
|
| in_subset | ||
| label |
isopentane |
|
| notation |
CHEBI:30362 |
|
| prefLabel |
isopentane |
|
| textual definition |
An alkane that is butane substituted by a methyl group at position 2. |
|
| subClassOf |