Preferred Name |
L-alanine |
|
Synonyms |
L-alanine L-Alanine 89.09322 C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N (S)-alanine C3H7NO2 InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 L-alpha-alanine A L-alpha-Alanine (2S)-2-aminopropanoic acid L-Alanin 89.048 (S)-2-aminopropanoic acid L-2-Aminopropionic acid ALANINE 0 Ala |
|
Definitions |
The L-enantiomer of alanine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16977 |
|
database_cross_reference |
Wikipedia:Alanine KEGG:D00012 YMDB:YMDB00154 Beilstein:1720248 CAS:56-41-7 PMID:18235971 MetaCyc:ALPHA-ALANINE KEGG:C00041 PMID:22735334 Gmelin:49628 KNApSAcK:C00001332 ECMDB:ECMDB00161 DrugBank:DB00160 Reaxys:1720248 PMID:3275662 PDBeChem:ALA_LFOH HMDB:HMDB00161 Drug_Central:4255 |
|
has exact synonym |
L-alanine L-Alanine |
|
has role | ||
has_alternative_id |
CHEBI:40735 CHEBI:46308 CHEBI:13069 CHEBI:40734 CHEBI:6171 CHEBI:21216 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
89.09322 C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N (S)-alanine C3H7NO2 InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 L-alpha-alanine A L-alpha-Alanine (2S)-2-aminopropanoic acid L-Alanin 89.048 (S)-2-aminopropanoic acid L-2-Aminopropionic acid ALANINE 0 Ala |
|
id |
CHEBI:16977 |
|
in_subset | ||
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-alanine |
|
notation |
CHEBI:16977 |
|
prefLabel |
L-alanine |
|
textual definition |
The L-enantiomer of alanine. |
|
subClassOf |