Preferred Name |
succinic acid |
|
Synonyms |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid Dihydrofumaric acid 118.027 acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum 118.08800 KDYFGRWQOYBRFD-UHFFFAOYSA-N Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O amber acid 0 acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure |
|
Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
database_cross_reference |
MetaCyc:SUC Drug_Central:2487 Reaxys:1754069 PMID:17439666 HMDB:HMDB00254 CAS:110-15-6 KEGG:C00042 Wikipedia:Succinic_acid LIPID_MAPS_instance:LMFA01170043 ECMDB:ECMDB00254 DrugBank:DB00139 PDBeChem:SIN Beilstein:1754069 Gmelin:2785 YMDB:YMDB00338 KNApSAcK:C00001205 |
|
has exact synonym |
butanedioic acid SUCCINIC ACID succinic acid Succinic acid |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_66987 http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
has_alternative_id |
CHEBI:9304 CHEBI:22943 CHEBI:45639 CHEBI:26807 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dihydrofumaric acid 118.027 acide succinique Butandisaeure InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) asuccin acidum succinicum 118.08800 KDYFGRWQOYBRFD-UHFFFAOYSA-N Ethylenesuccinic acid HOOC-CH2-CH2-COOH Butanedionic acid OC(=O)CCC(O)=O amber acid 0 acide butanedioique 1,2-ethanedicarboxylic acid E363 C4H6O4 spirit of amber Bernsteinsaeure |
|
id |
CHEBI:15741 |
|
in_subset | ||
is conjugate acid of | ||
label |
succinic acid |
|
notation |
CHEBI:15741 |
|
prefLabel |
succinic acid |
|
textual definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
subClassOf |