Preferred Name |
pantothenate |
|
Synonyms |
N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alaninate pantothenate 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
|
Definitions |
A monocarboxylic acid anion that is the conjugate base of pantothenic acid, obtained by deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16454 |
|
charge |
-1 |
|
database_cross_reference |
PMID:21463532 |
|
definition |
A monocarboxylic acid anion that is the conjugate base of pantothenic acid, obtained by deprotonation of the carboxy group. |
|
formula |
C9H16NO5 |
|
has characteristic | ||
has role | ||
has_exact_synonym |
pantothenate 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
|
has_related_synonym |
N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alaninate |
|
hasAlternativeId |
CHEBI:14739 CHEBI:25846 |
|
hasOBONamespace |
chebi_ontology |
|
id |
CHEBI:16454 |
|
inchi |
InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1 |
|
inchikey |
GHOKWGTUZJEAQD-UHFFFAOYSA-M |
|
inSubset | ||
is_conjugate_base_of | ||
label |
pantothenate |
|
mass |
218.22700 |
|
monoisotopicmass |
218.10340 |
|
notation |
CHEBI:16454 |
|
prefLabel |
pantothenate |
|
smiles |
CC(C)(CO)C(O)C(=O)NCCC([O-])=O |
|
subClassOf |