loading...| Preferred Name |
pantothenate |
|
| Synonyms |
N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alaninate pantothenate 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
|
| Definitions |
A monocarboxylic acid anion that is the conjugate base of pantothenic acid, obtained by deprotonation of the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16454 |
|
| charge |
-1 |
|
| database_cross_reference |
PMID:21463532 |
|
| definition |
A monocarboxylic acid anion that is the conjugate base of pantothenic acid, obtained by deprotonation of the carboxy group. |
|
| formula |
C9H16NO5 |
|
| has characteristic | ||
| has role | ||
| has_exact_synonym |
pantothenate 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
|
| has_related_synonym |
N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alaninate |
|
| hasAlternativeId |
CHEBI:14739 CHEBI:25846 |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:16454 |
|
| inchi |
InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1 |
|
| inchikey |
GHOKWGTUZJEAQD-UHFFFAOYSA-M |
|
| inSubset | ||
| is_conjugate_base_of | ||
| label |
pantothenate |
|
| mass |
218.22700 |
|
| monoisotopicmass |
218.10340 |
|
| notation |
CHEBI:16454 |
|
| prefLabel |
pantothenate |
|
| smiles |
CC(C)(CO)C(O)C(=O)NCCC([O-])=O |
|
| subClassOf |