Preferred Name |
eltrombopag |
|
Synonyms |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazinyl}-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid 3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazino}-2'-hydroxybiphenyl-3-carboxylic acid |
|
Definitions |
A hydrazine in which each nitrogen atom is substituted, one by a 3'-carboxy-2-hydroxy[1,1'-biphenyl]-3-yl group and the other by a 1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene group. A small molecule agonist of the c-mpl (TpoR) receptor (the physiological target of the hormone thrombopoietin), it has been developed as a medication for conditions that lead to thrombocytopenia (abnormally low platelet counts). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_85010 |
|
charge |
0 |
|
chemical effective in vitro against virus | ||
chemical has protein target as agonist | ||
database_cross_reference |
PMID:24433306 PMID:25063763 PMID:25170628 Wikipedia:Eltrombopag CAS:496775-61-2 Drug_Central:4399 PMID:25578417 PMID:25700916 PMID:25400215 |
|
definition |
A hydrazine in which each nitrogen atom is substituted, one by a 3'-carboxy-2-hydroxy[1,1'-biphenyl]-3-yl group and the other by a 1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene group. A small molecule agonist of the c-mpl (TpoR) receptor (the physiological target of the hormone thrombopoietin), it has been developed as a medication for conditions that lead to thrombocytopenia (abnormally low platelet counts). |
|
definition source |
https://www.drugbank.ca/drugs/DB06210 PMID: 32366720 |
|
formula |
C25H22N4O4 |
|
has exact synonym |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazinyl}-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3'-{(2Z)-2-[1-(3,4-dimethylphenyl)-3-methyl-5-oxo-1,5-dihydro-4H-pyrazol-4-ylidene]hydrazino}-2'-hydroxybiphenyl-3-carboxylic acid |
|
id |
CHEBI:85010 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C25H22N4O4/c1-14-10-11-19(12-15(14)2)29-24(31)22(16(3)28-29)27-26-21-9-5-8-20(23(21)30)17-6-4-7-18(13-17)25(32)33/h4-13,26,30H,1-3H3,(H,32,33)/b27-22- |
|
inchikey |
XDXWLKQMMKQXPV-QYQHSDTDSA-N |
|
label |
eltrombopag |
|
mass |
442.46660 |
|
monoisotopicmass |
442.16411 |
|
notation |
CHEBI:85010 |
|
prefLabel |
eltrombopag |
|
smiles |
CC1=NN(C(=O)\C1=N/Nc1cccc(-c2cccc(c2)C(O)=O)c1O)c1ccc(C)c(C)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22723 |