Preferred Name |
mycophenolate |
|
Synonyms |
mycophenolate (4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|
Definitions |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of mycophenolic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_62932 |
|
charge |
-1 |
|
definition |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of mycophenolic acid. |
|
formula |
C17H19O6 |
|
has exact synonym |
mycophenolate (4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:62932 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/p-1/b9-4+ |
|
inchikey |
HPNSFSBZBAHARI-RUDMXATFSA-M |
|
is conjugate base of | ||
label |
mycophenolate |
|
mass |
319.32920 |
|
monoisotopicmass |
319.11871 |
|
notation |
CHEBI:62932 |
|
prefLabel |
mycophenolate |
|
smiles |
COc1c(C)c2COC(=O)c2c(O)c1C\C=C(/C)CCC([O-])=O |
|
subClassOf |