loading...| Preferred Name |
clomipramine hydrochloride |
|
| Synonyms |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride clomipramine monohydrochloride clomipramine HCl chloroimipramine monohydrochloride 3-chloroimipramine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride Anafranil |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3755 |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| database_cross_reference |
KEGG:D00811 VSDB:1812 Reaxys:4168494 CAS:17321-77-6 DrugBank:DB01242 |
|
| definition |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| definition source |
PMID: 24841273 |
|
| formula |
C19H24Cl2N2 |
|
| has exact synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_48278 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
clomipramine monohydrochloride clomipramine HCl chloroimipramine monohydrochloride 3-chloroimipramine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride Anafranil |
|
| id |
CHEBI:3755 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
|
| inchikey |
WIMWMKZEIBHDTH-UHFFFAOYSA-N |
|
| label |
clomipramine hydrochloride |
|
| mass |
351.31300 |
|
| monoisotopicmass |
350.13165 |
|
| notation |
CHEBI:3755 |
|
| prefLabel |
clomipramine hydrochloride |
|
| smiles |
Cl.CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12 |
|
| subClassOf |