Jump to:
loading...| Preferred Name |
Chloroquine [Chemical/Ingredient] |
|
| Synonyms |
|
|
| ID |
http://evs.nci.nih.gov/ftp1/NDF-RT/NDF-RT.owl#N0000007737 |
|
| code |
C25834 |
|
| Display_Name |
Chloroquine |
|
| imported from | ||
| label |
Chloroquine [Chemical/Ingredient] |
|
| MeSH_CUI |
M0004182 |
|
| MeSH_Definition |
The prototypical antimalarial agent with a mechanism that is not well understood. It has also been used to treat rheumatoid arthritis, systemic lupus erythematosus, and in the systemic therapy of amebic liver abscesses. |
|
| MeSH_DUI |
D002738 |
|
| MeSH_Name |
Chloroquine |
|
| NUI |
N0000007737 |
|
| prefixIRI |
NDF-RT:N0000007737 |
|
| prefLabel |
Chloroquine [Chemical/Ingredient] |
|
| RxNorm_CUI |
2393 |
|
| RxNorm_Name |
Chloroquine |
|
| Synonym |
1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl- Chingamin Chlorochin Khingamin |
|
| UMLS_CUI |
C0008269 |
|
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://evs.nci.nih.gov/ftp1/NDF-RT/NDF-RT.owl#N0000007737 | CIDO | SAME_URI | |
| http://evs.nci.nih.gov/ftp1/NDF-RT/NDF-RT.owl#N0000007737 | CIDO | LOOM | |
| http://purl.bioontology.org/ontology/NDFRT/N0000007737 | NDFRT | LOOM |