loading...| Preferred Name |
arachidic acid |
|
| Synonyms |
CCCCCCCCCCCCCCCCCCCC(O)=O n-eicosanoic acid InChIKey=VKOBVWXKNCXXDE-UHFFFAOYSA-N Eicosanoic acid Icosanoic acid InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) Arachinsaeure C20H40O2 arachidinic acid CH3-[CH2]18-COOH eicosoic acid icosanoic acid Arachidic acid |
|
| Definitions |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28822 |
|
| database_cross_reference |
ChemIDplus:506-30-9 Gmelin:854866 CiteXplore:17279692 LIPID MAPS:LMFA01010020 CiteXplore:18036601 NIST Chemistry WebBook:506-30-9 KEGG COMPOUND:506-30-9 KEGG COMPOUND:C06425 CiteXplore:19908738 Beilstein:1788211 |
|
| definition |
A C20 striaght-chain saturated fatty acid which forms a minor constituent of peanut (L. arachis) and corn oils. Used as an organic thin film in the production of liquid crystals for a wide variety of technical applications. |
|
| has_alternative_id |
CHEBI:24763 CHEBI:2798 |
|
| has_exact_synonym |
icosanoic acid Arachidic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CCCCCCCCCCCCCCCCCCCC(O)=O n-eicosanoic acid InChIKey=VKOBVWXKNCXXDE-UHFFFAOYSA-N Eicosanoic acid Icosanoic acid InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) Arachinsaeure C20H40O2 arachidinic acid CH3-[CH2]18-COOH eicosoic acid |
|
| id |
CHEBI:28822 |
|
| imported from | ||
| label |
arachidic acid |
|
| notation |
CHEBI:28822 |
|
| prefixIRI |
CHEBI:28822 |
|
| prefLabel |
arachidic acid |
|
| subClassOf |