loading...| Preferred Name |
pantothenic acid |
|
| Synonyms |
Pantothenic acid 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) CC(C)(CO)C(O)C(=O)NCCC(O)=O C9H17NO5 N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine InChIKey=GHOKWGTUZJEAQD-UHFFFAOYSA-N |
|
| Definitions |
The amide formed from pantoic acid and beta-alanine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7916 |
|
| database_cross_reference |
Reaxys:1727062 KEGG COMPOUND:C00864 DrugBank:DB01783 KEGG DRUG:D07413 Wikipedia:Pantothenic_acid ChemIDplus:599-54-2 Beilstein:1727062 |
|
| definition |
The amide formed from pantoic acid and beta-alanine. |
|
| has_exact_synonym |
Pantothenic acid 3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) CC(C)(CO)C(O)C(=O)NCCC(O)=O C9H17NO5 N-(2,4-dihydroxy-3,3-dimethylbutanoyl)-beta-alanine InChIKey=GHOKWGTUZJEAQD-UHFFFAOYSA-N |
|
| id |
CHEBI:7916 |
|
| imported from | ||
| label |
pantothenic acid |
|
| notation |
CHEBI:7916 |
|
| prefixIRI |
CHEBI:7916 |
|
| prefLabel |
pantothenic acid |
|
| subClassOf |