loading...| Preferred Name |
monensin A |
|
| Synonyms |
(2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-{(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-3'-methyloctahydro-2,2'-bifuran-5-yl}-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]-3-methoxy-2-methylpentanoic acid Monensin A monensic acid Monensin monensin monensina monensinum |
|
| Definitions |
A spiroketal, monensin A is the major component of monensin, a mixture of antibiotic substances produced by Streptomyces cinnamonensis. An antiprotozoal, it is used as the sodium salt as a feed additive for the prevention of coccidiosis in poultry and as a growth promoter in cattle. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27617 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08228 LINCS:LSM-5659 Reaxys:1633130 CAS:17090-79-8 KEGG:C06693 PMID:21215424 |
|
| definition |
A spiroketal, monensin A is the major component of monensin, a mixture of antibiotic substances produced by Streptomyces cinnamonensis. An antiprotozoal, it is used as the sodium salt as a feed additive for the prevention of coccidiosis in poultry and as a growth promoter in cattle. |
|
| formula |
C36H62O11 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_24869 |
|
| has_alternative_id |
CHEBI:25376 CHEBI:6973 |
|
| has_exact_synonym |
(2S,3R,4S)-4-[(2S,5R,7S,8R,9S)-2-{(2S,2'R,3'S,5R,5'R)-2-ethyl-5'-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyltetrahydro-2H-pyran-2-yl]-3'-methyloctahydro-2,2'-bifuran-5-yl}-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro[4.5]dec-7-yl]-3-methoxy-2-methylpentanoic acid Monensin A |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
monensic acid Monensin monensin monensina monensinum |
|
| id |
CHEBI:27617 |
|
| in_subset | ||
| inchi |
InChI=1S/C36H62O11/c1-10-34(31-20(3)16-26(43-31)28-19(2)15-21(4)36(41,18-37)46-28)12-11-27(44-34)33(8)13-14-35(47-33)17-25(38)22(5)30(45-35)23(6)29(42-9)24(7)32(39)40/h19-31,37-38,41H,10-18H2,1-9H3,(H,39,40)/t19-,20-,21+,22+,23-,24-,25-,26+,27+,28-,29+,30-,31+,33-,34-,35+,36-/m0/s1 |
|
| inchikey |
GAOZTHIDHYLHMS-KEOBGNEYSA-N |
|
| label |
monensin A |
|
| mass |
670.87090 |
|
| monoisotopicmass |
670.42921 |
|
| notation |
CHEBI:27617 |
|
| prefLabel |
monensin A |
|
| smiles |
[H][C@@]1(C[C@H](C)[C@@]([H])(O1)[C@]1(CC)CC[C@@]([H])(O1)[C@]1(C)CC[C@]2(C[C@H](O)[C@@H](C)[C@]([H])(O2)[C@@H](C)[C@@H](OC)[C@H](C)C(O)=O)O1)[C@@]1([H])O[C@@](O)(CO)[C@H](C)C[C@@H]1C |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_59780 http://purl.obolibrary.org/obo/CHEBI_25384 |