Preferred Name |
octanoate |
|
Synonyms |
octanoate n-octanoate 1-heptanecarboxylate n-caprylate octanoic acid, ion(1-) CH3-[CH2]6-COO(-) caprilate caprylate n-octoate n-octylate octylate |
|
Definitions |
A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25646 |
|
charge |
-1 |
|
database_cross_reference |
Reaxys:3588079 PMID:11983812 Gmelin:329219 CAS:74-81-7 UM-BBD_compID:c0047 Beilstein:3588079 |
|
definition |
A straight-chain saturated fatty acid anion that is the conjugate base of octanoic acid (caprylic acid); believed to block adipogenesis. |
|
formula |
C8H15O2 |
|
has role | ||
has_exact_synonym |
octanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
n-octanoate 1-heptanecarboxylate n-caprylate octanoic acid, ion(1-) CH3-[CH2]6-COO(-) caprilate caprylate n-octoate n-octylate octylate |
|
id |
CHEBI:25646 |
|
in_subset | ||
inchi |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/p-1 |
|
inchikey |
WWZKQHOCKIZLMA-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
octanoate |
|
mass |
143.204 |
|
monoisotopicmass |
143.10775 |
|
notation |
CHEBI:25646 |
|
prefLabel |
octanoate |
|
smiles |
C(CCCCCC)C(=O)[O-] |
|
subClassOf |