Preferred Name |
L-alanine |
|
Synonyms |
L-Alanine L-alanine (S)-alanine (S)-2-aminopropanoic acid L-alpha-Alanine L-alpha-alanine (2S)-2-aminopropanoic acid L-2-Aminopropionic acid A ALANINE Ala L-Alanin |
|
Definitions |
The L-enantiomer of alanine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16977 |
|
charge |
0 |
|
database_cross_reference |
ECMDB:ECMDB00161 YMDB:YMDB00154 Drug_Central:4255 Reaxys:1720248 DrugBank:DB00160 PDBeChem:ALA_LFOH HMDB:HMDB0000161 MetaCyc:ALPHA-ALANINE KEGG:C00041 PMID:3275662 PMID:18235971 KEGG:D00012 Gmelin:49628 Beilstein:1720248 PMID:22735334 CAS:56-41-7 KNApSAcK:C00001332 Wikipedia:Alanine |
|
definition |
The L-enantiomer of alanine. |
|
formula |
C3H7NO2 |
|
has role | ||
has_alternative_id |
CHEBI:40734 CHEBI:40735 CHEBI:21216 CHEBI:13069 CHEBI:46308 CHEBI:6171 |
|
has_exact_synonym |
L-Alanine L-alanine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(S)-alanine (S)-2-aminopropanoic acid L-alpha-Alanine L-alpha-alanine (2S)-2-aminopropanoic acid L-2-Aminopropionic acid A ALANINE Ala L-Alanin |
|
id |
CHEBI:16977 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
|
inchikey |
QNAYBMKLOCPYGJ-REOHCLBHSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-alanine |
|
mass |
89.09322 |
|
monoisotopicmass |
89.04768 |
|
notation |
CHEBI:16977 |
|
prefLabel |
L-alanine |
|
smiles |
C[C@H](N)C(O)=O |
|
subClassOf |