Jump to:
loading...| Preferred Name |
malic acid |
|
| Synonyms |
|
|
| Definitions |
A 2-hydroxydicarboxylic acid that is succinic acid in which one of the hydrogens attached to a carbon is replaced by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6650 |
|
| BiomarkerOf | ||
| ChemSpider |
14080972 | 510 |
|
| FOBI |
FOBI:030632 |
|
| HMDB |
HMDB00744 |
|
| id |
CHEBI:6650 |
|
| imported from | ||
| InChICode |
InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9) |
|
| InChIKey |
BJEPYKJPYRNKOW-UHFFFAOYSA-N |
|
| KEGG |
C00711 | C03668 | D04843 |
|
| label |
malic acid |
|
| notation |
CHEBI:6650 |
|
| prefixIRI |
CHEBI:6650 |
|
| prefLabel |
malic acid |
|
| PubChemCID |
20130941 | 525 |
|
| textual definition |
A 2-hydroxydicarboxylic acid that is succinic acid in which one of the hydrogens attached to a carbon is replaced by a hydroxy group. |
|
| subClassOf |
Create mapping