Preferred Name |
ranitidine |
|
Synonyms |
(E)-N-{2-[({5-[(dimethylamino)methyl]-2-furyl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine ranitidina ranitidinum ranitidine |
|
Definitions |
A member of the class of furans used to treat peptic ulcer disease (PUD) and gastroesophageal reflux disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8776 |
|
charge |
0 |
|
database_cross_reference |
PMID:19694603 Wikipedia:Ranitidine Reaxys:4327819 Beilstein:4327819 PMID:18609122 Patent:US4128658 HMDB:HMDB0001930 DrugBank:DB00863 KEGG:D00422 CAS:66357-35-5 Patent:FR2384765 |
|
definition |
A member of the class of furans used to treat peptic ulcer disease (PUD) and gastroesophageal reflux disease. |
|
formula |
C13H22N4O3S |
|
has_exact_synonym |
(E)-N-{2-[({5-[(dimethylamino)methyl]-2-furyl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
ranitidina ranitidinum ranitidine |
|
id |
CHEBI:8776 |
|
in_subset | ||
inchi |
InChI=1S/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3/b13-9+ |
|
inchikey |
VMXUWOKSQNHOCA-UKTHLTGXSA-N |
|
label |
ranitidine |
|
mass |
314.40400 |
|
monoisotopicmass |
314.14126 |
|
notation |
CHEBI:8776 |
|
prefLabel |
ranitidine |
|
smiles |
CN\C(NCCSCc1ccc(CN(C)C)o1)=C/[N+]([O-])=O |
|
subClassOf |