Preferred Name |
venlafaxine |
|
Synonyms |
Venlafaxine 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexanol Elafax venlafaxine venlafaxinum venlafaxina |
|
Definitions |
A tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-methoxyphenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9943 |
|
charge |
0 |
|
database_cross_reference |
PMID:12409680 Beilstein:4234848 PMID:18321472 LINCS:LSM-1616 KEGG:D08670 CAS:93413-69-5 PMID:11098420 DrugBank:DB00285 Drug_Central:2813 HMDB:HMDB0005016 Reaxys:4234848 KEGG:C07187 Wikipedia:Venlafaxine |
|
definition |
A tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-methoxyphenyl group. |
|
formula |
C17H27NO2 |
|
has_exact_synonym |
Venlafaxine 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexanol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Elafax venlafaxine venlafaxinum venlafaxina |
|
id |
CHEBI:9943 |
|
in_subset | ||
inchi |
InChI=1S/C17H27NO2/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3 |
|
inchikey |
PNVNVHUZROJLTJ-UHFFFAOYSA-N |
|
label |
venlafaxine |
|
mass |
277.40182 |
|
monoisotopicmass |
277.20418 |
|
notation |
CHEBI:9943 |
|
prefLabel |
venlafaxine |
|
smiles |
COc1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 |
|
subClassOf |