loading...| Preferred Name |
bezafibrate |
|
| Synonyms |
2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid Bezatol SR (TN) bezafibratum bezafibrato Cedur Befizal 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid Bezalip bezafibrate |
|
| Definitions |
A monocarboxylic acid amide obtained by the formal condensation of the carboxy group of 4-chlorobenzoic acid with the amino group of 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoic acid. Benafibrate is used for the treatment of hyperlipidaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_47612 |
|
| charge |
0 |
|
| database_cross_reference |
Chemspider:35728 DrugBank:DB01393 KEGG:D01366 PMID:18787029 PMID:33205029 PMID:32976735 PMID:32798077 PMID:34447954 PMID:12782154 LINCS:LSM-3015 CAS:41859-67-0 HMDB:HMDB0015465 PMID:23603800 PMID:12122004 Wikipedia:Bezafibrate Patent:US3781328 Patent:DE2149070 PMID:17379010 PMID:33549744 PMID:32107855 PMID:32721217 Drug_Central:362 PDBeChem:PEM Reaxys:4267656 PMID:28931607 PMID:19131462 PMID:32509533 |
|
| definition |
A monocarboxylic acid amide obtained by the formal condensation of the carboxy group of 4-chlorobenzoic acid with the amino group of 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoic acid. Benafibrate is used for the treatment of hyperlipidaemia. |
|
| formula |
C19H20ClNO4 |
|
| has_alternative_id |
CHEBI:47611 CHEBI:31284 |
|
| has_exact_synonym |
2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Bezatol SR (TN) bezafibratum bezafibrato Cedur Befizal 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid Bezalip bezafibrate |
|
| id |
CHEBI:47612 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
|
| inchikey |
IIBYAHWJQTYFKB-UHFFFAOYSA-N |
|
| label |
bezafibrate |
|
| mass |
361.820 |
|
| monoisotopicmass |
361.10809 |
|
| notation |
CHEBI:47612 |
|
| prefLabel |
bezafibrate |
|
| smiles |
CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O |
|
| subClassOf |