loading...| Preferred Name |
clomipramine hydrochloride |
|
| Synonyms |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride clomipramine monohydrochloride clomipramine HCl chloroimipramine monohydrochloride 3-chloroimipramine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride Anafranil |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3755 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG DRUG:17321-77-6 KEGG DRUG:D00811 NCIt:C47458 ChEMBL:774661 SNOMEDCT:116520006 Reaxys:4168494 SNOMEDCT:387027004 ChemIDplus:17321-77-6 KEGG:D00811 VSDB:1812 CAS:17321-77-6 DrugBank:DB01242 |
|
| definition |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| formula |
C19H24Cl2N2 |
|
| has_exact_synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
clomipramine monohydrochloride clomipramine HCl chloroimipramine monohydrochloride 3-chloroimipramine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride Anafranil |
|
| id |
CHEBI:3755 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
|
| inchikey |
WIMWMKZEIBHDTH-UHFFFAOYSA-N |
|
| label |
clomipramine hydrochloride |
|
| mass |
351.31300 |
|
| monoisotopicmass |
350.13165 |
|
| notation |
CHEBI:3755 |
|
| prefLabel |
clomipramine hydrochloride |
|
| smiles |
Cl.CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12 |
|
| subClassOf |