loading...| Preferred Name |
carvacrol |
|
| Synonyms |
Carvacrol carvacrol 2-methyl-5-(propan-2-yl)phenol 1-Hydroxy-2-methyl-5-isopropylbenzene 3-Isopropyl-6-methylphenol 2-Hydroxy-p-cymene 2-Methyl-5-isopropylphenol 5-Isopropyl-o-cresol 2-p-Cymenol 2-Methyl-5-(1-methylethyl)phenol 5-Isopropyl-2-methylphenol 1-Methyl-2-hydroxy-4-isopropylbenzene |
|
| Definitions |
A phenol that is a natural monoterpene derivative of cymene. An inhibitor of bacterial growth, it is used as a food additive. Potent activator of the human ion channels transient receptor potential V3 (TRPV3) and A1 (TRPA1). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3440 |
|
| charge |
0 |
|
| database_cross_reference |
ChemIDplus:499-75-2 MeSH:C073316 CiteXplore:21879312 KEGG COMPOUND:C09840 CiteXplore:22305883 CiteXplore:22308777 CiteXplore:22129102 ChemIDplus:1860514 NIST Chemistry WebBook:499-75-2 CiteXplore:22139435 ChEMBL:138580 CiteXplore:21544887 CiteXplore:22328722 NCIt:C83602 SNOMEDCT:109231009 CiteXplore:22002497 CiteXplore:22289589 CiteXplore:22273461 KEGG COMPOUND:499-75-2 CiteXplore:21938469 CiteXplore:21815724 CiteXplore:22183117 CiteXplore:21447440 PMID:22002497 PMID:22328722 CAS:499-75-2 PMID:22289589 KEGG:C09840 Wikipedia:Carvacrol PMID:21815724 PMID:22139435 LIPID_MAPS_instance:LMPR0102090017 PMID:21879312 PMID:22308777 KNApSAcK:C00000156 PMID:22273461 PMID:22129102 PMID:22183117 PMID:21447440 Beilstein:1860514 PMID:21544887 PMID:21938469 PMID:22305883 |
|
| definition |
A phenol that is a natural monoterpene derivative of cymene. An inhibitor of bacterial growth, it is used as a food additive. Potent activator of the human ion channels transient receptor potential V3 (TRPV3) and A1 (TRPA1). |
|
| formula |
C10H14O |
|
| has_exact_synonym |
Carvacrol carvacrol 2-methyl-5-(propan-2-yl)phenol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Hydroxy-2-methyl-5-isopropylbenzene 3-Isopropyl-6-methylphenol 2-Hydroxy-p-cymene 2-Methyl-5-isopropylphenol 5-Isopropyl-o-cresol 2-p-Cymenol 2-Methyl-5-(1-methylethyl)phenol 5-Isopropyl-2-methylphenol 1-Methyl-2-hydroxy-4-isopropylbenzene |
|
| has_role | ||
| id |
CHEBI:3440 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
|
| inchikey |
RECUKUPTGUEGMW-UHFFFAOYSA-N |
|
| label |
carvacrol |
|
| mass |
150.21760 |
|
| monoisotopicmass |
150.10447 |
|
| notation |
CHEBI:3440 |
|
| prefLabel |
carvacrol |
|
| smiles |
CC(C)c1ccc(C)c(O)c1 |
|
| subClassOf |