Preferred Name |
lactate |
|
Synonyms |
lactate 2-hydroxypropanoate b-lactate beta-lactate MeCH(OH)CO2 anion 2-hydroxypropanoic acid, ion(1-) 2-hydroxypropionate |
|
Definitions |
A hydroxy monocarboxylic acid anion that is the conjugate base of lactic acid, arising from deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_24996 |
|
charge |
-1 |
|
database_cross_reference |
CAS:113-21-3 Gmelin:240074 KEGG:C01432 MetaCyc:Lactate Beilstein:3587719 |
|
definition |
A hydroxy monocarboxylic acid anion that is the conjugate base of lactic acid, arising from deprotonation of the carboxy group. |
|
formula |
C3H5O3 |
|
has_exact_synonym |
lactate 2-hydroxypropanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
b-lactate beta-lactate MeCH(OH)CO2 anion 2-hydroxypropanoic acid, ion(1-) 2-hydroxypropionate |
|
id |
CHEBI:24996 |
|
in_subset | ||
inchi |
InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/p-1 |
|
inchikey |
JVTAAEKCZFNVCJ-UHFFFAOYSA-M |
|
label |
lactate |
|
mass |
89.07000 |
|
monoisotopicmass |
89.02442 |
|
notation |
CHEBI:24996 |
|
prefLabel |
lactate |
|
smiles |
CC(O)C([O-])=O |
|
subClassOf |