Jump to:
loading...| Preferred Name |
phenylacetate |
|
| Synonyms |
phenylacetate phenylacetate anion phenylacetate(1-) 2-phenylacetate phenylacetic acid anion 2-phenylethanoate |
|
| Definitions |
A monocarboxylic acid anion that is the conjugate base of phenylacetic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18401 |
|
| charge |
-1 |
|
| database_cross_reference |
MetaCyc:PHENYLACETATE Reaxys:3539899 Beilstein:3539899 UM-BBD_compID:c0211 Gmelin:327522 |
|
| definition |
A monocarboxylic acid anion that is the conjugate base of phenylacetic acid. |
|
| formula |
C8H7O2 |
|
| has_alternative_id |
CHEBI:25975 CHEBI:14779 |
|
| has_exact_synonym |
phenylacetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
phenylacetate anion phenylacetate(1-) 2-phenylacetate phenylacetic acid anion 2-phenylethanoate |
|
| id |
CHEBI:18401 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/p-1 |
|
| inchikey |
WLJVXDMOQOGPHL-UHFFFAOYSA-M |
|
| label |
phenylacetate |
|
| mass |
135.13998 |
|
| monoisotopicmass |
135.04515 |
|
| notation |
CHEBI:18401 |
|
| prefLabel |
phenylacetate |
|
| smiles |
[O-]C(=O)Cc1ccccc1 |
|
| subClassOf |
Create mapping