Preferred Name |
butyrate |
|
Synonyms |
butyrate butanoate butanoic acid, ion(1-) propylformate 1-butyrate propanecarboxylate butanate 1-butanoate n-butyrate 1-propanecarboxylate CH3-[CH2]2-COO(-) n-butanoate |
|
Definitions |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17968 |
|
charge |
-1 |
|
database_cross_reference |
Gmelin:324289 Reaxys:3601060 CiteXplore:17190852 ChEBI:C00246 CiteXplore:7496326 ChEBI:c0035 Beilstein:3601060 ChemIDplus:461-55-2 PMID:7496326 KEGG:C00246 UM-BBD_compID:c0035 PMID:17190852 MetaCyc:BUTYRIC_ACID CAS:461-55-2 |
|
definition |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
formula |
C4H7O2 |
|
has_alternative_id |
CHEBI:13924 CHEBI:22946 |
|
has_exact_synonym |
butyrate butanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
butanoic acid, ion(1-) propylformate 1-butyrate propanecarboxylate butanate 1-butanoate n-butyrate 1-propanecarboxylate CH3-[CH2]2-COO(-) n-butanoate butanoate |
|
id |
CHEBI:17968 |
|
in_subset | ||
inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
|
inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-M |
|
label |
butyrate |
|
mass |
87.09718 |
|
monoisotopicmass |
87.04515 |
|
notation |
CHEBI:17968 |
|
prefLabel |
butyrate |
|
smiles |
CCCC([O-])=O |
|
subClassOf |