Preferred Name |
cystine |
|
Synonyms |
Cystine 3,3'-disulfanediylbis(2-aminopropanoic acid) cystine Dicysteine Cystin 3,3'-dithiobis(2-aminopropanoic acid) Zystin alpha-Diamino-beta-dithiolactic acid cistina |
|
Definitions |
A sulfur-containing amino acid obtained by the oxidation of two cysteine molecules which are then linked via a disulfide bond. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17376 |
|
charge |
0 |
|
database_cross_reference |
PMID:18608550 KEGG:C01420 PMID:24525029 PMID:24327171 Wikipedia:Cystine Reaxys:1728091 CAS:923-32-0 Beilstein:1728091 Gmelin:83347 PMID:24525030 |
|
definition |
A sulfur-containing amino acid obtained by the oxidation of two cysteine molecules which are then linked via a disulfide bond. |
|
formula |
C6H12N2O4S2 |
|
has_alternative_id |
CHEBI:14062 CHEBI:4052 CHEBI:23513 |
|
has_exact_synonym |
Cystine 3,3'-disulfanediylbis(2-aminopropanoic acid) cystine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dicysteine Cystin 3,3'-dithiobis(2-aminopropanoic acid) Zystin alpha-Diamino-beta-dithiolactic acid cistina |
|
id |
CHEBI:17376 |
|
in_subset | ||
inchi |
InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
|
inchikey |
LEVWYRKDKASIDU-UHFFFAOYSA-N |
|
label |
cystine |
|
mass |
240.30256 |
|
monoisotopicmass |
240.02385 |
|
notation |
CHEBI:17376 |
|
prefLabel |
cystine |
|
smiles |
NC(CSSCC(N)C(O)=O)C(O)=O |
|
subClassOf |